ChemNet > CAS > 220497-69-8 (S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester
220497-69-8 (S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester
| product Name |
(S)-2-(Cyclohexylmethyl)succinic acid-1-methyl ester |
| Synonyms |
(S)-4-Cyclohexyl-3-(methoxycarbonyl)butyric acid; (S)-(-)-2-(Cyclohexylmethyl)succinic acid 1-methyl ester; (S)-4-Methoxy-3-cyclohexylmethyl-4-oxobutanoic Acid; (3S)-3-(cyclohexylmethyl)-4-methoxy-4-oxobutanoic acid |
| Molecular Formula |
C12H20O4 |
| Molecular Weight |
228.2848 |
| InChI |
InChI=1/C12H20O4/c1-16-12(15)10(8-11(13)14)7-9-5-3-2-4-6-9/h9-10H,2-8H2,1H3,(H,13,14)/t10-/m0/s1 |
| CAS Registry Number |
220497-69-8 |
| Molecular Structure |
|
| Density |
1.094g/cm3 |
| Boiling point |
360.4°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
133.2°C |
| Vapour Pressur |
3.59E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
